C11H9ClN2O6S — CID 82913683
3-chlorosulfonyl-4-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid (PubChem CID 82913683) has the molecular formula C11H9ClN2O6S and a molecular weight of 332.72 g/mol. Its IUPAC name is 3-chlorosulfonyl-4-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 3-chlorosulfonyl-4-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 82913683 |
| Molecular Formula | C11H9ClN2O6S |
| Molecular Weight | 332.72 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 3-chlorosulfonyl-4-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid |
| SMILES | N#CCNC(=O)COc1ccc(C(=O)O)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H9ClN2O6S/c12-21(18,19)9-5-7(11(16)17)1-2-8(9)20-6-10(15)14-4-3-13/h1-2,5H,4,6H2,(H,14,15)(H,16,17) |
| InChIKey | ANERTQWGUUURDI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.72 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|