C10H8ClF3O5S — CID 64553954
3-chlorosulfonyl-4-(3,3,3-trifluoropropoxy)benzoic acid (PubChem CID 64553954) has the molecular formula C10H8ClF3O5S and a molecular weight of 332.68 g/mol. Its IUPAC name is 3-chlorosulfonyl-4-(3,3,3-trifluoropropoxy)benzoic acid.
| Compound Name | 3-chlorosulfonyl-4-(3,3,3-trifluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 64553954 |
| Molecular Formula | C10H8ClF3O5S |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 3-chlorosulfonyl-4-(3,3,3-trifluoropropoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(OCCC(F)(F)F)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C10H8ClF3O5S/c11-20(17,18)8-5-6(9(15)16)1-2-7(8)19-4-3-10(12,13)14/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | KRYJWIVXXHZBIT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |