C10H9ClF4O3S — CID 113326287
5-fluoro-2-(4,4,4-trifluorobutoxy)benzenesulfonyl chloride (PubChem CID 113326287) has the molecular formula C10H9ClF4O3S and a molecular weight of 320.69 g/mol. Its IUPAC name is 5-fluoro-2-(4,4,4-trifluorobutoxy)benzenesulfonyl chloride.
| Compound Name | 5-fluoro-2-(4,4,4-trifluorobutoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 113326287 |
| Molecular Formula | C10H9ClF4O3S |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 5-fluoro-2-(4,4,4-trifluorobutoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(F)ccc1OCCCC(F)(F)F |
| InChI | InChI=1S/C10H9ClF4O3S/c11-19(16,17)9-6-7(12)2-3-8(9)18-5-1-4-10(13,14)15/h2-3,6H,1,4-5H2 |
| InChIKey | CJOOOWZOYDHVRZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|