C11H13ClFNO4S — CID 82910267
2-[3-(ethylamino)-3-oxopropoxy]-5-fluorobenzenesulfonyl chloride (PubChem CID 82910267) has the molecular formula C11H13ClFNO4S and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-[3-(ethylamino)-3-oxopropoxy]-5-fluorobenzenesulfonyl chloride.
| Compound Name | 2-[3-(ethylamino)-3-oxopropoxy]-5-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82910267 |
| Molecular Formula | C11H13ClFNO4S |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[3-(ethylamino)-3-oxopropoxy]-5-fluorobenzenesulfonyl chloride |
| SMILES | CCNC(=O)CCOc1ccc(F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H13ClFNO4S/c1-2-14-11(15)5-6-18-9-4-3-8(13)7-10(9)19(12,16)17/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | RVKIWAWGSAIDPC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |