C12H16ClFO4S — CID 103020699
5-fluoro-2-(3-methoxy-3-methylbutoxy)benzenesulfonyl chloride (PubChem CID 103020699) has the molecular formula C12H16ClFO4S and a molecular weight of 310.77 g/mol. Its IUPAC name is 5-fluoro-2-(3-methoxy-3-methylbutoxy)benzenesulfonyl chloride.
| Compound Name | 5-fluoro-2-(3-methoxy-3-methylbutoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 103020699 |
| Molecular Formula | C12H16ClFO4S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-fluoro-2-(3-methoxy-3-methylbutoxy)benzenesulfonyl chloride |
| SMILES | COC(C)(C)CCOc1ccc(F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C12H16ClFO4S/c1-12(2,17-3)6-7-18-10-5-4-9(14)8-11(10)19(13,15)16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | PXRYXQHAQNOQDS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |