C26H25NO7S — CID 155794524
4-(3,6-dimethoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate (PubChem CID 155794524) has the molecular formula C26H25NO7S and a molecular weight of 495.55 g/mol. Its IUPAC name is 4-(3,6-dimethoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate.
| Compound Name | 4-(3,6-dimethoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 155794524 |
| Molecular Formula | C26H25NO7S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 4-(3,6-dimethoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate |
| SMILES | COc1ccc2c(C(=O)Oc3ccccc3)c3ccc(OC)cc3[n+](CCCCS(=O)(=O)[O-])c2c1 |
| InChI | InChI=1S/C26H25NO7S/c1-32-19-10-12-21-23(16-19)27(14-6-7-15-35(29,30)31)24-17-20(33-2)11-13-22(24)25(21)26(28)34-18-8-4-3-5-9-18/h3-5,8-13,16-17H,6-7,14-15H2,1-2H3 |
| InChIKey | KVNFOYBRWHGKIN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|