C36H34NO8S+ — CID 18683348
10-[4-(4-carboxy-2,6-dimethylphenoxy)sulfonylbutyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-9-carboxylic acid (PubChem CID 18683348) has the molecular formula C36H34NO8S+ and a molecular weight of 640.73 g/mol. Its IUPAC name is 10-[4-(4-carboxy-2,6-dimethylphenoxy)sulfonylbutyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-9-carboxylic acid.
| Compound Name | 10-[4-(4-carboxy-2,6-dimethylphenoxy)sulfonylbutyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-9-carboxylic acid |
|---|---|
| PubChem CID | 18683348 |
| Molecular Formula | C36H34NO8S+ |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | 10-[4-(4-carboxy-2,6-dimethylphenoxy)sulfonylbutyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-9-carboxylic acid |
| SMILES | COc1ccc(/C=C/c2ccc3c(c2)c(C(=O)O)c2ccccc2[n+]3CCCCS(=O)(=O)Oc2c(C)cc(C(=O)O)cc2C)cc1 |
| InChI | InChI=1S/C36H33NO8S/c1-23-20-27(35(38)39)21-24(2)34(23)45-46(42,43)19-7-6-18-37-31-9-5-4-8-29(31)33(36(40)41)30-22-26(14-17-32(30)37)11-10-25-12-15-28(44-3)16-13-25/h4-5,8-17,20-22H,6-7,18-19H2,1-3H3,(H-,38,39,40,41)/p+1/b11-10+ |
| InChIKey | WTCMFNKGLYBYGJ-ZHACJKMWSA-O |
| XLogP | 6.66 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|