C27H25NO8S — CID 87470531
4-[9-carboxy-2-methoxy-10-(3-sulfopropyl)acridin-10-ium-1-yl]-3,5-dimethylbenzoate (PubChem CID 87470531) has the molecular formula C27H25NO8S and a molecular weight of 523.56 g/mol. Its IUPAC name is 4-[9-carboxy-2-methoxy-10-(3-sulfopropyl)acridin-10-ium-1-yl]-3,5-dimethylbenzoate.
| Compound Name | 4-[9-carboxy-2-methoxy-10-(3-sulfopropyl)acridin-10-ium-1-yl]-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 87470531 |
| Molecular Formula | C27H25NO8S |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 4-[9-carboxy-2-methoxy-10-(3-sulfopropyl)acridin-10-ium-1-yl]-3,5-dimethylbenzoate |
| SMILES | COc1ccc2c(c1-c1c(C)cc(C(=O)[O-])cc1C)c(C(=O)O)c1ccccc1[n+]2CCCS(=O)(=O)O |
| InChI | InChI=1S/C27H25NO8S/c1-15-13-17(26(29)30)14-16(2)22(15)25-21(36-3)10-9-20-24(25)23(27(31)32)18-7-4-5-8-19(18)28(20)11-6-12-37(33,34)35/h4-5,7-10,13-14H,6,11-12H2,1-3H3,(H2-,29,30,31,32,33,34,35) |
| InChIKey | YHDLSWHRFKXYFU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|