C25H23NO6S — CID 172860519
4-(2-methoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate (PubChem CID 172860519) has the molecular formula C25H23NO6S and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-(2-methoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate.
| Compound Name | 4-(2-methoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 172860519 |
| Molecular Formula | C25H23NO6S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4-(2-methoxy-9-phenoxycarbonylacridin-10-ium-10-yl)butane-1-sulfonate |
| SMILES | COc1ccc2c(c1)c(C(=O)Oc1ccccc1)c1ccccc1[n+]2CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C25H23NO6S/c1-31-19-13-14-23-21(17-19)24(25(27)32-18-9-3-2-4-10-18)20-11-5-6-12-22(20)26(23)15-7-8-16-33(28,29)30/h2-6,9-14,17H,7-8,15-16H2,1H3 |
| InChIKey | ZHCSPWPOEQVARV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|