C36H29N2O7+ — CID 18683368
[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenyl] 2-[(E)-2-(4-hydroxyphenyl)ethenyl]-10-methylacridin-10-ium-9-carboxylate (PubChem CID 18683368) has the molecular formula C36H29N2O7+ and a molecular weight of 601.64 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenyl] 2-[(E)-2-(4-hydroxyphenyl)ethenyl]-10-methylacridin-10-ium-9-carboxylate.
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenyl] 2-[(E)-2-(4-hydroxyphenyl)ethenyl]-10-methylacridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 18683368 |
| Molecular Formula | C36H29N2O7+ |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenyl] 2-[(E)-2-(4-hydroxyphenyl)ethenyl]-10-methylacridin-10-ium-9-carboxylate |
| SMILES | Cc1cc(C(=O)ON2C(=O)CCC2=O)cc(C)c1OC(=O)c1c2ccccc2[n+](C)c2ccc(/C=C/c3ccc(O)cc3)cc12 |
| InChI | InChI=1S/C36H28N2O7/c1-21-18-25(35(42)45-38-31(40)16-17-32(38)41)19-22(2)34(21)44-36(43)33-27-6-4-5-7-29(27)37(3)30-15-12-24(20-28(30)33)9-8-23-10-13-26(39)14-11-23/h4-15,18-20H,16-17H2,1-3H3/p+1 |
| InChIKey | JIFKDXRZBVINKG-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|