About [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate
[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate (PubChem CID 88632344) has the molecular formula C25H16N2O6
and a molecular weight of 440.41 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate.
Molecular Properties
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate |
| PubChem CID | 88632344 |
| Molecular Formula | C25H16N2O6 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(OC(=O)c2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H16N2O6/c28-21-13-14-22(29)27(21)33-24(30)15-9-11-16(12-10-15)32-25(31)23-17-5-1-3-7-19(17)26-20-8-4-2-6-18(20)23/h1-12H,13-14H2 |
| InChIKey | AJFMIKAECLRKQW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate?
The IUPAC name of [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate (CID 88632344) is [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate.
What is the SMILES notation for [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate?
The canonical SMILES for [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate is O=C(ON1C(=O)CCC1=O)c1ccc(OC(=O)c2c3ccccc3nc3ccccc23)cc1.
What is the InChIKey of [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate?
The InChIKey is AJFMIKAECLRKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16N2O6/c28-21-13-14-22(29)27(21)33-24(30)15-9-11-16(12-10-15)32-25(31)23-17-5-1-3-7-19(17)26-20-8-4-2-6-18(20)23/h1-12H,13-14H2.
What are the key properties of [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate?
[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate has a molecular weight of 440.41 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate is sourced from PubChem (CID 88632344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).