C25H16N2O6 — CID 88632344
[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate (PubChem CID 88632344) has the molecular formula C25H16N2O6 and a molecular weight of 440.41 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate.
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate |
|---|---|
| PubChem CID | 88632344 |
| Molecular Formula | C25H16N2O6 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl] acridine-9-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(OC(=O)c2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H16N2O6/c28-21-13-14-22(29)27(21)33-24(30)15-9-11-16(12-10-15)32-25(31)23-17-5-1-3-7-19(17)26-20-8-4-2-6-18(20)23/h1-12H,13-14H2 |
| InChIKey | AJFMIKAECLRKQW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|