About [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate
[4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate (PubChem CID 21267469) has the molecular formula C24H22N2O4
and a molecular weight of 402.45 g/mol. Its IUPAC name is [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate.
Molecular Properties
| Compound Name | [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate |
| PubChem CID | 21267469 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate |
| SMILES | NCCOCCOc1ccc(OC(=O)c2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N2O4/c25-13-14-28-15-16-29-17-9-11-18(12-10-17)30-24(27)23-19-5-1-3-7-21(19)26-22-8-4-2-6-20(22)23/h1-12H,13-16,25H2 |
| InChIKey | VLUPZPHYVDCWNS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate?
The IUPAC name of [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate (CID 21267469) is [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate.
What is the SMILES notation for [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate?
The canonical SMILES for [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate is NCCOCCOc1ccc(OC(=O)c2c3ccccc3nc3ccccc23)cc1.
What is the InChIKey of [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate?
The InChIKey is VLUPZPHYVDCWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O4/c25-13-14-28-15-16-29-17-9-11-18(12-10-17)30-24(27)23-19-5-1-3-7-21(19)26-22-8-4-2-6-20(22)23/h1-12H,13-16,25H2.
What are the key properties of [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate?
[4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate has a molecular weight of 402.45 g/mol, XLogP of 3.96, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2-aminoethoxy)ethoxy]phenyl] acridine-9-carboxylate is sourced from PubChem (CID 21267469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).