About [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate
[4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate (PubChem CID 59928962) has the molecular formula C26H18N2O4S
and a molecular weight of 454.51 g/mol. Its IUPAC name is [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate.
Molecular Properties
| Compound Name | [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate |
| PubChem CID | 59928962 |
| Molecular Formula | C26H18N2O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate |
| SMILES | O=C(Oc1ccc(SCCN2C(=O)C=CC2=O)cc1)c1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C26H18N2O4S/c29-23-13-14-24(30)28(23)15-16-33-18-11-9-17(10-12-18)32-26(31)25-19-5-1-3-7-21(19)27-22-8-4-2-6-20(22)25/h1-14H,15-16H2 |
| InChIKey | IKBZHBIRDURGBH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate?
The IUPAC name of [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate (CID 59928962) is [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate.
What is the SMILES notation for [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate?
The canonical SMILES for [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate is O=C(Oc1ccc(SCCN2C(=O)C=CC2=O)cc1)c1c2ccccc2nc2ccccc12.
What is the InChIKey of [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate?
The InChIKey is IKBZHBIRDURGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N2O4S/c29-23-13-14-24(30)28(23)15-16-33-18-11-9-17(10-12-18)32-26(31)25-19-5-1-3-7-21(19)27-22-8-4-2-6-20(22)25/h1-14H,15-16H2.
What are the key properties of [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate?
[4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate has a molecular weight of 454.51 g/mol, XLogP of 4.62, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate is sourced from PubChem (CID 59928962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).