C26H18N2O4S — CID 59928962
[4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate (PubChem CID 59928962) has the molecular formula C26H18N2O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate.
| Compound Name | [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate |
|---|---|
| PubChem CID | 59928962 |
| Molecular Formula | C26H18N2O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [4-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]phenyl] acridine-9-carboxylate |
| SMILES | O=C(Oc1ccc(SCCN2C(=O)C=CC2=O)cc1)c1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C26H18N2O4S/c29-23-13-14-24(30)28(23)15-16-33-18-11-9-17(10-12-18)32-26(31)25-19-5-1-3-7-21(19)27-22-8-4-2-6-20(22)25/h1-14H,15-16H2 |
| InChIKey | IKBZHBIRDURGBH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|