C17H11NO5 — CID 145370236
(2,5-dioxopyrrolidin-1-yl) dibenzofuran-2-carboxylate (PubChem CID 145370236) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) dibenzofuran-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) dibenzofuran-2-carboxylate |
|---|---|
| PubChem CID | 145370236 |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) dibenzofuran-2-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C17H11NO5/c19-15-7-8-16(20)18(15)23-17(21)10-5-6-14-12(9-10)11-3-1-2-4-13(11)22-14/h1-6,9H,7-8H2 |
| InChIKey | IIQGZKKWEAPQJH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|