C13H18N2O8S3 — CID 168738459
1-[3-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 168738459) has the molecular formula C13H18N2O8S3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-[3-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[3-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 168738459 |
| Molecular Formula | C13H18N2O8S3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 1-[3-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | C=C(C)C(=O)NCCSSCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H18N2O8S3/c1-8(2)12(18)14-4-6-25-24-5-3-11(17)23-15-10(16)7-9(13(15)19)26(20,21)22/h9H,1,3-7H2,2H3,(H,14,18)(H,20,21,22) |
| InChIKey | BHWPIUBPGBPKRQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|