C13H13NNaO8S — CID 131864330
CID 131864330 (PubChem CID 131864330) has the molecular formula C13H13NNaO8S and a molecular weight of 366.30 g/mol.
| Compound Name | CID 131864330 |
|---|---|
| PubChem CID | 131864330 |
| Molecular Formula | C13H13NNaO8S |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | — |
| SMILES | O=C(CCc1ccc(O)cc1)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] |
| InChI | InChI=1S/C13H13NO8S.Na/c15-9-4-1-8(2-5-9)3-6-12(17)22-14-11(16)7-10(13(14)18)23(19,20)21;/h1-2,4-5,10,15H,3,6-7H2,(H,19,20,21); |
| InChIKey | IHZKMHCPNUGQBY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|