C13H13NO8S — CID 21225461
2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 21225461) has the molecular formula C13H13NO8S and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 21225461 |
| Molecular Formula | C13H13NO8S |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)N1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H13NO8S/c15-8-3-1-7(2-4-8)5-9(13(18)19)14-11(16)6-10(12(14)17)23(20,21)22/h1-4,9-10,15H,5-6H2,(H,18,19)(H,20,21,22) |
| InChIKey | CMBXLYBAHHTDOW-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|