C33H56N6O10S2 — CID 158036367
4-azido-2-hydroxy-N-[8-(methyldisulfanyl)-6-oxooctyl]benzamide;3-[2-[2-[2-[2-[3-(ethylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide (PubChem CID 158036367) has the molecular formula C33H56N6O10S2 and a molecular weight of 760.98 g/mol. Its IUPAC name is 4-azido-2-hydroxy-N-[8-(methyldisulfanyl)-6-oxooctyl]benzamide;3-[2-[2-[2-[2-[3-(ethylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide.
| Compound Name | 4-azido-2-hydroxy-N-[8-(methyldisulfanyl)-6-oxooctyl]benzamide;3-[2-[2-[2-[2-[3-(ethylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 158036367 |
| Molecular Formula | C33H56N6O10S2 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 760.35 |
| IUPAC Name | 4-azido-2-hydroxy-N-[8-(methyldisulfanyl)-6-oxooctyl]benzamide;3-[2-[2-[2-[2-[3-(ethylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-methylpropanamide |
| SMILES | CCNC(=O)CCOCCOCCOCCOCCOCCC(=O)NC.CSSCCC(=O)CCCCCNC(=O)c1ccc(N=[N+]=[N-])cc1O |
| InChI | InChI=1S/C17H34N2O7.C16H22N4O3S2/c1-3-19-17(21)5-7-23-9-11-25-13-15-26-14-12-24-10-8-22-6-4-16(20)18-2;1-24-25-10-8-13(21)5-3-2-4-9-18-16(23)14-7-6-12(19-20-17)11-15(14)22/h3-15H2,1-2H3,(H,18,20)(H,19,21);6-7,11,22H,2-5,8-10H2,1H3,(H,18,23) |
| InChIKey | FHUHURHEVJXIFF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 219.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|