C24H22ClN5O3 — CID 18763161
4-azido-N-[3-[[2-[(E)-2-(3-chlorophenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]propyl]-2-hydroxybenzamide (PubChem CID 18763161) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is 4-azido-N-[3-[[2-[(E)-2-(3-chlorophenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]propyl]-2-hydroxybenzamide.
| Compound Name | 4-azido-N-[3-[[2-[(E)-2-(3-chlorophenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]propyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 18763161 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 4-azido-N-[3-[[2-[(E)-2-(3-chlorophenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]propyl]-2-hydroxybenzamide |
| SMILES | Cc1ccc(OCCCNC(=O)c2ccc(N=[N+]=[N-])cc2O)c(/C=C/c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C24H22ClN5O3/c1-16-6-11-23(21(28-16)10-7-17-4-2-5-18(25)14-17)33-13-3-12-27-24(32)20-9-8-19(29-30-26)15-22(20)31/h2,4-11,14-15,31H,3,12-13H2,1H3,(H,27,32)/b10-7+ |
| InChIKey | DZIHAKBBLXIDHF-JXMROGBWSA-N |
| XLogP | 6.06 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|