C19H24N4O6S2 — CID 134455246
(2,5-dioxopyrrolidin-1-yl) 3-[2-[3-(phenyldisulfanyl)propanoylamino]ethylcarbamoylamino]propanoate (PubChem CID 134455246) has the molecular formula C19H24N4O6S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[3-(phenyldisulfanyl)propanoylamino]ethylcarbamoylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[3-(phenyldisulfanyl)propanoylamino]ethylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 134455246 |
| Molecular Formula | C19H24N4O6S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[3-(phenyldisulfanyl)propanoylamino]ethylcarbamoylamino]propanoate |
| SMILES | O=C(CCSSc1ccccc1)NCCNC(=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H24N4O6S2/c24-15(9-13-30-31-14-4-2-1-3-5-14)20-11-12-22-19(28)21-10-8-18(27)29-23-16(25)6-7-17(23)26/h1-5H,6-13H2,(H,20,24)(H2,21,22,28) |
| InChIKey | SDKLYBDNXVDXNP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|