C10H14BN2O5 — CID 89330987
CID 89330987 (PubChem CID 89330987) has the molecular formula C10H14BN2O5 and a molecular weight of 253.04 g/mol.
| Compound Name | CID 89330987 |
|---|---|
| PubChem CID | 89330987 |
| Molecular Formula | C10H14BN2O5 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | — |
| SMILES | C[B]CC(=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H14BN2O5/c1-11-6-7(14)12-5-4-10(17)18-13-8(15)2-3-9(13)16/h2-6H2,1H3,(H,12,14) |
| InChIKey | YYVPSFMPYZHPNL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|