C19H23F9N2O5S2 — CID 11365376
(2,5-dioxopyrrolidin-1-yl) 6-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyldisulfanyl)propanoylamino]hexanoate (PubChem CID 11365376) has the molecular formula C19H23F9N2O5S2 and a molecular weight of 594.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyldisulfanyl)propanoylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyldisulfanyl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 11365376 |
| Molecular Formula | C19H23F9N2O5S2 |
| Molecular Weight | 594.52 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexyldisulfanyl)propanoylamino]hexanoate |
| SMILES | O=C(CCSSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H23F9N2O5S2/c20-16(21,17(22,23)18(24,25)19(26,27)28)8-11-37-36-10-7-12(31)29-9-3-1-2-4-15(34)35-30-13(32)5-6-14(30)33/h1-11H2,(H,29,31) |
| InChIKey | GQWFCOSKUVVYMM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|