C19H30N4O8 — CID 89119031
(2,5-dioxopyrrolidin-1-yl) 6-[[4-acetamido-5-(2-hydroxyethylamino)-5-oxopentanoyl]amino]hexanoate (PubChem CID 89119031) has the molecular formula C19H30N4O8 and a molecular weight of 442.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[4-acetamido-5-(2-hydroxyethylamino)-5-oxopentanoyl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[4-acetamido-5-(2-hydroxyethylamino)-5-oxopentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 89119031 |
| Molecular Formula | C19H30N4O8 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[4-acetamido-5-(2-hydroxyethylamino)-5-oxopentanoyl]amino]hexanoate |
| SMILES | CC(=O)NC(CCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O)C(=O)NCCO |
| InChI | InChI=1S/C19H30N4O8/c1-13(25)22-14(19(30)21-11-12-24)6-7-15(26)20-10-4-2-3-5-18(29)31-23-16(27)8-9-17(23)28/h14,24H,2-12H2,1H3,(H,20,26)(H,21,30)(H,22,25) |
| InChIKey | DLZYPUBJGSIBOG-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|