C16H26N4O6 — CID 135254373
(2,5-dioxopyrrolidin-1-yl) 3-[[6-acetamido-2-(methylamino)hexanoyl]amino]propanoate (PubChem CID 135254373) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[6-acetamido-2-(methylamino)hexanoyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[6-acetamido-2-(methylamino)hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 135254373 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[6-acetamido-2-(methylamino)hexanoyl]amino]propanoate |
| SMILES | CNC(CCCCNC(C)=O)C(=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H26N4O6/c1-11(21)18-9-4-3-5-12(17-2)16(25)19-10-8-15(24)26-20-13(22)6-7-14(20)23/h12,17H,3-10H2,1-2H3,(H,18,21)(H,19,25) |
| InChIKey | NAXDINCNJNELRH-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|