C21H25N4O5PS4 — CID 118423964
(2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(pyridin-2-yldisulfanyl)ethyl]phosphorylamino]propanoate (PubChem CID 118423964) has the molecular formula C21H25N4O5PS4 and a molecular weight of 572.70 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(pyridin-2-yldisulfanyl)ethyl]phosphorylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(pyridin-2-yldisulfanyl)ethyl]phosphorylamino]propanoate |
|---|---|
| PubChem CID | 118423964 |
| Molecular Formula | C21H25N4O5PS4 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-(pyridin-2-yldisulfanyl)ethyl]phosphorylamino]propanoate |
| SMILES | O=C(CCNP(=O)(CCSSc1ccccn1)CCSSc1ccccn1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H25N4O5PS4/c26-19-7-8-20(27)25(19)30-21(28)9-12-24-31(29,13-15-32-34-17-5-1-3-10-22-17)14-16-33-35-18-6-2-4-11-23-18/h1-6,10-11H,7-9,12-16H2,(H,24,29) |
| InChIKey | FVKQAGJPPHIJSA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|