C11H17N2O4PS2 — CID 157222868
3-[[hydroxy-[3-(pyridin-2-yldisulfanyl)propyl]phosphoryl]amino]propanoic acid (PubChem CID 157222868) has the molecular formula C11H17N2O4PS2 and a molecular weight of 336.38 g/mol. Its IUPAC name is 3-[[hydroxy-[3-(pyridin-2-yldisulfanyl)propyl]phosphoryl]amino]propanoic acid.
| Compound Name | 3-[[hydroxy-[3-(pyridin-2-yldisulfanyl)propyl]phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 157222868 |
| Molecular Formula | C11H17N2O4PS2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 3-[[hydroxy-[3-(pyridin-2-yldisulfanyl)propyl]phosphoryl]amino]propanoic acid |
| SMILES | O=C(O)CCNP(=O)(O)CCCSSc1ccccn1 |
| InChI | InChI=1S/C11H17N2O4PS2/c14-11(15)5-7-13-18(16,17)8-3-9-19-20-10-4-1-2-6-12-10/h1-2,4,6H,3,5,7-9H2,(H,14,15)(H2,13,16,17) |
| InChIKey | NLNYMBSAGYVMRI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|