C18H24N2O7S2 — CID 58402443
4-(2-carboxyethyl)-4-[3-(pyridin-2-yldisulfanyl)propanoylamino]heptanedioic acid (PubChem CID 58402443) has the molecular formula C18H24N2O7S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-(2-carboxyethyl)-4-[3-(pyridin-2-yldisulfanyl)propanoylamino]heptanedioic acid.
| Compound Name | 4-(2-carboxyethyl)-4-[3-(pyridin-2-yldisulfanyl)propanoylamino]heptanedioic acid |
|---|---|
| PubChem CID | 58402443 |
| Molecular Formula | C18H24N2O7S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-(2-carboxyethyl)-4-[3-(pyridin-2-yldisulfanyl)propanoylamino]heptanedioic acid |
| SMILES | O=C(O)CCC(CCC(=O)O)(CCC(=O)O)NC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C18H24N2O7S2/c21-13(7-12-28-29-14-3-1-2-11-19-14)20-18(8-4-15(22)23,9-5-16(24)25)10-6-17(26)27/h1-3,11H,4-10,12H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | ILXRYFPEVGJQNG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|