C12H17NOS2 — CID 87103492
4,4-dimethyl-1-(pyridin-2-yldisulfanyl)pentan-3-one (PubChem CID 87103492) has the molecular formula C12H17NOS2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 4,4-dimethyl-1-(pyridin-2-yldisulfanyl)pentan-3-one.
| Compound Name | 4,4-dimethyl-1-(pyridin-2-yldisulfanyl)pentan-3-one |
|---|---|
| PubChem CID | 87103492 |
| Molecular Formula | C12H17NOS2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4,4-dimethyl-1-(pyridin-2-yldisulfanyl)pentan-3-one |
| SMILES | CC(C)(C)C(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C12H17NOS2/c1-12(2,3)10(14)7-9-15-16-11-6-4-5-8-13-11/h4-6,8H,7,9H2,1-3H3 |
| InChIKey | DCFDVWJLGSROPW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|