C13H19NOS2 — CID 158904952
3,3-dimethyl-1-(pyridin-2-yldisulfanyl)butan-2-one;ethene (PubChem CID 158904952) has the molecular formula C13H19NOS2 and a molecular weight of 269.44 g/mol. Its IUPAC name is 3,3-dimethyl-1-(pyridin-2-yldisulfanyl)butan-2-one;ethene.
| Compound Name | 3,3-dimethyl-1-(pyridin-2-yldisulfanyl)butan-2-one;ethene |
|---|---|
| PubChem CID | 158904952 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3,3-dimethyl-1-(pyridin-2-yldisulfanyl)butan-2-one;ethene |
| SMILES | C=C.CC(C)(C)C(=O)CSSc1ccccn1 |
| InChI | InChI=1S/C11H15NOS2.C2H4/c1-11(2,3)9(13)8-14-15-10-6-4-5-7-12-10;1-2/h4-7H,8H2,1-3H3;1-2H2 |
| InChIKey | JFXUHQFQCSOZPB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|