About 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine
2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine (PubChem CID 174994599) has the molecular formula C16H19N3OS2
and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine.
Molecular Properties
| Compound Name | 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine |
| PubChem CID | 174994599 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine |
| SMILES | CCC=C(C)C(N)=O.c1ccc(SSc2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2S2.C6H11NO/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;1-3-4-5(2)6(7)8/h1-8H;4H,3H2,1-2H3,(H2,7,8) |
| InChIKey | OTRRSAQKGNMNCD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine?
The IUPAC name of 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine (CID 174994599) is 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine.
What is the SMILES notation for 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine?
The canonical SMILES for 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine is CCC=C(C)C(N)=O.c1ccc(SSc2ccccn2)nc1.
What is the InChIKey of 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine?
The InChIKey is OTRRSAQKGNMNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S2.C6H11NO/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;1-3-4-5(2)6(7)8/h1-8H;4H,3H2,1-2H3,(H2,7,8).
What are the key properties of 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine?
2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine has a molecular weight of 333.48 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-2-enamide;2-(pyridin-2-yldisulfanyl)pyridine is sourced from PubChem (CID 174994599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).