About isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine
isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine (PubChem CID 122690557) has the molecular formula C13H13N3OS2
and a molecular weight of 291.40 g/mol. Its IUPAC name is isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine.
Molecular Properties
| Compound Name | isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine |
| PubChem CID | 122690557 |
| Molecular Formula | C13H13N3OS2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine |
| SMILES | CCN=C=O.c1ccc(SSc2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2S2.C3H5NO/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;1-2-4-3-5/h1-8H;2H2,1H3 |
| InChIKey | FTSYSFXXJVYNMQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine?
The IUPAC name of isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine (CID 122690557) is isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine.
What is the SMILES notation for isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine?
The canonical SMILES for isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine is CCN=C=O.c1ccc(SSc2ccccn2)nc1.
What is the InChIKey of isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine?
The InChIKey is FTSYSFXXJVYNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S2.C3H5NO/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;1-2-4-3-5/h1-8H;2H2,1H3.
What are the key properties of isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine?
isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine has a molecular weight of 291.40 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanatoethane;2-(pyridin-2-yldisulfanyl)pyridine is sourced from PubChem (CID 122690557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).