About 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride
2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride (PubChem CID 21452483) has the molecular formula C10H8Cl4N2S2Sn
and a molecular weight of 480.85 g/mol. Its IUPAC name is 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride.
Molecular Properties
| Compound Name | 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride |
| PubChem CID | 21452483 |
| Molecular Formula | C10H8Cl4N2S2Sn |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 479.79 |
| IUPAC Name | 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Sn+4].c1ccc(SSc2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2S2.4ClH.Sn/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;;;;;/h1-8H;4*1H;/q;;;;;+4/p-4 |
| InChIKey | KUXRXTNGQZUDSZ-UHFFFAOYSA-J |
| XLogP | -9.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | -9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride?
The IUPAC name of 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride (CID 21452483) is 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride.
What is the SMILES notation for 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride?
The canonical SMILES for 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride is [Cl-].[Cl-].[Cl-].[Cl-].[Sn+4].c1ccc(SSc2ccccn2)nc1.
What is the InChIKey of 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride?
The InChIKey is KUXRXTNGQZUDSZ-UHFFFAOYSA-J. The full InChI is InChI=1S/C10H8N2S2.4ClH.Sn/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;;;;;/h1-8H;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride?
2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride has a molecular weight of 480.85 g/mol, XLogP of -9.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridin-2-yldisulfanyl)pyridine;tin(4+);tetrachloride is sourced from PubChem (CID 21452483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).