C12H12N2S2 — CID 57270391
2,4-dimethyl-6-(pyridin-2-yldisulfanyl)pyridine (PubChem CID 57270391) has the molecular formula C12H12N2S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is 2,4-dimethyl-6-(pyridin-2-yldisulfanyl)pyridine.
| Compound Name | 2,4-dimethyl-6-(pyridin-2-yldisulfanyl)pyridine |
|---|---|
| PubChem CID | 57270391 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2,4-dimethyl-6-(pyridin-2-yldisulfanyl)pyridine |
| SMILES | Cc1cc(C)nc(SSc2ccccn2)c1 |
| InChI | InChI=1S/C12H12N2S2/c1-9-7-10(2)14-12(8-9)16-15-11-5-3-4-6-13-11/h3-8H,1-2H3 |
| InChIKey | PPFJVNDRROUVDL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|