C14H13NOS — CID 102926074
2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzaldehyde (PubChem CID 102926074) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzaldehyde.
| Compound Name | 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 102926074 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzaldehyde |
| SMILES | Cc1cc(C)nc(Sc2ccccc2C=O)c1 |
| InChI | InChI=1S/C14H13NOS/c1-10-7-11(2)15-14(8-10)17-13-6-4-3-5-12(13)9-16/h3-9H,1-2H3 |
| InChIKey | KTGNQXCFKVIIQX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|