C15H14N4S — CID 102927043
4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]quinazolin-2-amine (PubChem CID 102927043) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]quinazolin-2-amine.
| Compound Name | 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 102927043 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]quinazolin-2-amine |
| SMILES | Cc1cc(C)nc(Sc2nc(N)nc3ccccc23)c1 |
| InChI | InChI=1S/C15H14N4S/c1-9-7-10(2)17-13(8-9)20-14-11-5-3-4-6-12(11)18-15(16)19-14/h3-8H,1-2H3,(H2,16,18,19) |
| InChIKey | RYXNPMNVNUEUFU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |