About 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate
2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate (PubChem CID 157392300) has the molecular formula C15H25NOS3
and a molecular weight of 331.57 g/mol. Its IUPAC name is 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate.
Molecular Properties
| Compound Name | 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate |
| PubChem CID | 157392300 |
| Molecular Formula | C15H25NOS3 |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate |
| SMILES | CC(=O)SC(C)(C)C.CC(C)(C)SSc1ccccn1 |
| InChI | InChI=1S/C9H13NS2.C6H12OS/c1-9(2,3)12-11-8-6-4-5-7-10-8;1-5(7)8-6(2,3)4/h4-7H,1-3H3;1-4H3 |
| InChIKey | BMDMMFRAKMROBP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate?
The IUPAC name of 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate (CID 157392300) is 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate.
What is the SMILES notation for 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate?
The canonical SMILES for 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate is CC(=O)SC(C)(C)C.CC(C)(C)SSc1ccccn1.
What is the InChIKey of 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate?
The InChIKey is BMDMMFRAKMROBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS2.C6H12OS/c1-9(2,3)12-11-8-6-4-5-7-10-8;1-5(7)8-6(2,3)4/h4-7H,1-3H3;1-4H3.
What are the key properties of 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate?
2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate has a molecular weight of 331.57 g/mol, XLogP of 5.68, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butyldisulfanyl)pyridine;S-tert-butyl ethanethioate is sourced from PubChem (CID 157392300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).