C13H20NO4PS2 — CID 118341991
3-[hydroxy-[3-methyl-3-(pyridin-2-yldisulfanyl)butyl]phosphoryl]propanoic acid (PubChem CID 118341991) has the molecular formula C13H20NO4PS2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-[hydroxy-[3-methyl-3-(pyridin-2-yldisulfanyl)butyl]phosphoryl]propanoic acid.
| Compound Name | 3-[hydroxy-[3-methyl-3-(pyridin-2-yldisulfanyl)butyl]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 118341991 |
| Molecular Formula | C13H20NO4PS2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-[hydroxy-[3-methyl-3-(pyridin-2-yldisulfanyl)butyl]phosphoryl]propanoic acid |
| SMILES | CC(C)(CCP(=O)(O)CCC(=O)O)SSc1ccccn1 |
| InChI | InChI=1S/C13H20NO4PS2/c1-13(2,21-20-11-5-3-4-8-14-11)7-10-19(17,18)9-6-12(15)16/h3-5,8H,6-7,9-10H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BNXQCVJGGSYBOQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|