C20H33NO2S2 — CID 146565828
2,6-dimethyl-2-[2-methyl-2-(pyridin-2-yldisulfanyl)propoxy]nonan-5-one (PubChem CID 146565828) has the molecular formula C20H33NO2S2 and a molecular weight of 383.62 g/mol. Its IUPAC name is 2,6-dimethyl-2-[2-methyl-2-(pyridin-2-yldisulfanyl)propoxy]nonan-5-one.
| Compound Name | 2,6-dimethyl-2-[2-methyl-2-(pyridin-2-yldisulfanyl)propoxy]nonan-5-one |
|---|---|
| PubChem CID | 146565828 |
| Molecular Formula | C20H33NO2S2 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2,6-dimethyl-2-[2-methyl-2-(pyridin-2-yldisulfanyl)propoxy]nonan-5-one |
| SMILES | CCCC(C)C(=O)CCC(C)(C)OCC(C)(C)SSc1ccccn1 |
| InChI | InChI=1S/C20H33NO2S2/c1-7-10-16(2)17(22)12-13-19(3,4)23-15-20(5,6)25-24-18-11-8-9-14-21-18/h8-9,11,14,16H,7,10,12-13,15H2,1-6H3 |
| InChIKey | YUOFFGMYVUXSNQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|