C17H29NOS2 — CID 156707093
2-[(2,4,4-trimethyl-5-propoxyhexan-2-yl)disulfanyl]pyridine (PubChem CID 156707093) has the molecular formula C17H29NOS2 and a molecular weight of 327.56 g/mol. Its IUPAC name is 2-[(2,4,4-trimethyl-5-propoxyhexan-2-yl)disulfanyl]pyridine.
| Compound Name | 2-[(2,4,4-trimethyl-5-propoxyhexan-2-yl)disulfanyl]pyridine |
|---|---|
| PubChem CID | 156707093 |
| Molecular Formula | C17H29NOS2 |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[(2,4,4-trimethyl-5-propoxyhexan-2-yl)disulfanyl]pyridine |
| SMILES | CCCOC(C)C(C)(C)CC(C)(C)SSc1ccccn1 |
| InChI | InChI=1S/C17H29NOS2/c1-7-12-19-14(2)16(3,4)13-17(5,6)21-20-15-10-8-9-11-18-15/h8-11,14H,7,12-13H2,1-6H3 |
| InChIKey | MIKGCRRDRHZYLR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|