C12H12N2O4S2 — CID 91090926
(pyridin-2-yldisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)propanoate (PubChem CID 91090926) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (pyridin-2-yldisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)propanoate.
| Compound Name | (pyridin-2-yldisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 91090926 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (pyridin-2-yldisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)propanoate |
| SMILES | CC(C(=O)OSSc1ccccn1)n1c(O)ccc1O |
| InChI | InChI=1S/C12H12N2O4S2/c1-8(14-10(15)5-6-11(14)16)12(17)18-20-19-9-4-2-3-7-13-9/h2-8,15-16H,1H3 |
| InChIKey | JPXMFQFDBCXHAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|