C13H14N2O4S2 — CID 90908564
2-(2,5-dihydroxypyrrol-1-yl)-4-(pyridin-2-yldisulfanyl)butanoic acid (PubChem CID 90908564) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-4-(pyridin-2-yldisulfanyl)butanoic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-4-(pyridin-2-yldisulfanyl)butanoic acid |
|---|---|
| PubChem CID | 90908564 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-4-(pyridin-2-yldisulfanyl)butanoic acid |
| SMILES | O=C(O)C(CCSSc1ccccn1)n1c(O)ccc1O |
| InChI | InChI=1S/C13H14N2O4S2/c16-11-4-5-12(17)15(11)9(13(18)19)6-8-20-21-10-3-1-2-7-14-10/h1-5,7,9,16-17H,6,8H2,(H,18,19) |
| InChIKey | QQISPSSISPZYBH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|