C19H24N2OS4 — CID 89140121
7,9-bis(pyridin-2-yldisulfanyl)non-1-en-2-ol (PubChem CID 89140121) has the molecular formula C19H24N2OS4 and a molecular weight of 424.68 g/mol. Its IUPAC name is 7,9-bis(pyridin-2-yldisulfanyl)non-1-en-2-ol.
| Compound Name | 7,9-bis(pyridin-2-yldisulfanyl)non-1-en-2-ol |
|---|---|
| PubChem CID | 89140121 |
| Molecular Formula | C19H24N2OS4 |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 7,9-bis(pyridin-2-yldisulfanyl)non-1-en-2-ol |
| SMILES | C=C(O)CCCCC(CCSSc1ccccn1)SSc1ccccn1 |
| InChI | InChI=1S/C19H24N2OS4/c1-16(22)8-2-3-9-17(24-26-19-11-5-7-14-21-19)12-15-23-25-18-10-4-6-13-20-18/h4-7,10-11,13-14,17,22H,1-3,8-9,12,15H2 |
| InChIKey | PPAMIYZVGTUAAA-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|