C10H16N3S2+ — CID 59074684
[1-amino-4-(pyridin-2-yldisulfanyl)butylidene]-methylazanium (PubChem CID 59074684) has the molecular formula C10H16N3S2+ and a molecular weight of 242.39 g/mol. Its IUPAC name is [1-amino-4-(pyridin-2-yldisulfanyl)butylidene]-methylazanium.
| Compound Name | [1-amino-4-(pyridin-2-yldisulfanyl)butylidene]-methylazanium |
|---|---|
| PubChem CID | 59074684 |
| Molecular Formula | C10H16N3S2+ |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | [1-amino-4-(pyridin-2-yldisulfanyl)butylidene]-methylazanium |
| SMILES | C/[NH+]=C(\N)CCCSSc1ccccn1 |
| InChI | InChI=1S/C10H15N3S2/c1-12-9(11)5-4-8-14-15-10-6-2-3-7-13-10/h2-3,6-7H,4-5,8H2,1H3,(H2,11,12)/p+1 |
| InChIKey | WSJJGOHVKWMJGT-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|