C12H20N4S2 — CID 158202412
1-tert-butyl-2-[2-(pyridin-2-yldisulfanyl)ethyl]guanidine (PubChem CID 158202412) has the molecular formula C12H20N4S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(pyridin-2-yldisulfanyl)ethyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-(pyridin-2-yldisulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 158202412 |
| Molecular Formula | C12H20N4S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-tert-butyl-2-[2-(pyridin-2-yldisulfanyl)ethyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CCSSc1ccccn1 |
| InChI | InChI=1S/C12H20N4S2/c1-12(2,3)16-11(13)15-8-9-17-18-10-6-4-5-7-14-10/h4-7H,8-9H2,1-3H3,(H3,13,15,16) |
| InChIKey | MCVFMBYCZZMBJE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|