C27H39N3S5 — CID 161313106
heptane-1-thiol;2-(pentyldisulfanyl)pyridine;2-(pyridin-2-yldisulfanyl)pyridine (PubChem CID 161313106) has the molecular formula C27H39N3S5 and a molecular weight of 565.97 g/mol. Its IUPAC name is heptane-1-thiol;2-(pentyldisulfanyl)pyridine;2-(pyridin-2-yldisulfanyl)pyridine.
| Compound Name | heptane-1-thiol;2-(pentyldisulfanyl)pyridine;2-(pyridin-2-yldisulfanyl)pyridine |
|---|---|
| PubChem CID | 161313106 |
| Molecular Formula | C27H39N3S5 |
| Molecular Weight | 565.97 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | heptane-1-thiol;2-(pentyldisulfanyl)pyridine;2-(pyridin-2-yldisulfanyl)pyridine |
| SMILES | CCCCCCCS.CCCCCSSc1ccccn1.c1ccc(SSc2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2S2.C10H15NS2.C7H16S/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;1-2-3-6-9-12-13-10-7-4-5-8-11-10;1-2-3-4-5-6-7-8/h1-8H;4-5,7-8H,2-3,6,9H2,1H3;8H,2-7H2,1H3 |
| InChIKey | VJDNNIKNCXOZJC-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 38.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.97 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|