About S-pyridin-2-yl octanethioate
S-pyridin-2-yl octanethioate (PubChem CID 13265438) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is S-pyridin-2-yl octanethioate.
Molecular Properties
| Compound Name | S-pyridin-2-yl octanethioate |
| PubChem CID | 13265438 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | S-pyridin-2-yl octanethioate |
| SMILES | CCCCCCCC(=O)Sc1ccccn1 |
| InChI | InChI=1S/C13H19NOS/c1-2-3-4-5-6-10-13(15)16-12-9-7-8-11-14-12/h7-9,11H,2-6,10H2,1H3 |
| InChIKey | JRVYPYKANCYOFX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pyridin-2-yl octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyridin-2-yl octanethioate?
The IUPAC name of S-pyridin-2-yl octanethioate (CID 13265438) is S-pyridin-2-yl octanethioate.
What is the SMILES notation for S-pyridin-2-yl octanethioate?
The canonical SMILES for S-pyridin-2-yl octanethioate is CCCCCCCC(=O)Sc1ccccn1.
What is the InChIKey of S-pyridin-2-yl octanethioate?
The InChIKey is JRVYPYKANCYOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-2-3-4-5-6-10-13(15)16-12-9-7-8-11-14-12/h7-9,11H,2-6,10H2,1H3.
What are the key properties of S-pyridin-2-yl octanethioate?
S-pyridin-2-yl octanethioate has a molecular weight of 237.37 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyridin-2-yl octanethioate is sourced from PubChem (CID 13265438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).