About S-pyridin-2-yl pent-4-ynethioate
S-pyridin-2-yl pent-4-ynethioate (PubChem CID 58762612) has the molecular formula C10H9NOS
and a molecular weight of 191.26 g/mol. Its IUPAC name is S-pyridin-2-yl pent-4-ynethioate.
Molecular Properties
| Compound Name | S-pyridin-2-yl pent-4-ynethioate |
| PubChem CID | 58762612 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | S-pyridin-2-yl pent-4-ynethioate |
| SMILES | C#CCCC(=O)Sc1ccccn1 |
| InChI | InChI=1S/C10H9NOS/c1-2-3-7-10(12)13-9-6-4-5-8-11-9/h1,4-6,8H,3,7H2 |
| InChIKey | AUTDUHVAIYLANZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-pyridin-2-yl pent-4-ynethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyridin-2-yl pent-4-ynethioate?
The IUPAC name of S-pyridin-2-yl pent-4-ynethioate (CID 58762612) is S-pyridin-2-yl pent-4-ynethioate.
What is the SMILES notation for S-pyridin-2-yl pent-4-ynethioate?
The canonical SMILES for S-pyridin-2-yl pent-4-ynethioate is C#CCCC(=O)Sc1ccccn1.
What is the InChIKey of S-pyridin-2-yl pent-4-ynethioate?
The InChIKey is AUTDUHVAIYLANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c1-2-3-7-10(12)13-9-6-4-5-8-11-9/h1,4-6,8H,3,7H2.
What are the key properties of S-pyridin-2-yl pent-4-ynethioate?
S-pyridin-2-yl pent-4-ynethioate has a molecular weight of 191.26 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyridin-2-yl pent-4-ynethioate is sourced from PubChem (CID 58762612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).