C11H15NO3S — CID 59992616
S-pyridin-2-yl 3-(2-methoxyethoxy)propanethioate (PubChem CID 59992616) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is S-pyridin-2-yl 3-(2-methoxyethoxy)propanethioate.
| Compound Name | S-pyridin-2-yl 3-(2-methoxyethoxy)propanethioate |
|---|---|
| PubChem CID | 59992616 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | S-pyridin-2-yl 3-(2-methoxyethoxy)propanethioate |
| SMILES | COCCOCCC(=O)Sc1ccccn1 |
| InChI | InChI=1S/C11H15NO3S/c1-14-8-9-15-7-5-11(13)16-10-4-2-3-6-12-10/h2-4,6H,5,7-9H2,1H3 |
| InChIKey | RZFMONHVUWKWHA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|