C19H21N3O2S2 — CID 146180888
(Z)-N,N-dimethyl-4-oxo-2,3-bis(pyridin-2-ylsulfanyl)hept-2-enamide (PubChem CID 146180888) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-4-oxo-2,3-bis(pyridin-2-ylsulfanyl)hept-2-enamide.
| Compound Name | (Z)-N,N-dimethyl-4-oxo-2,3-bis(pyridin-2-ylsulfanyl)hept-2-enamide |
|---|---|
| PubChem CID | 146180888 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (Z)-N,N-dimethyl-4-oxo-2,3-bis(pyridin-2-ylsulfanyl)hept-2-enamide |
| SMILES | CCCC(=O)/C(Sc1ccccn1)=C(/Sc1ccccn1)C(=O)N(C)C |
| InChI | InChI=1S/C19H21N3O2S2/c1-4-9-14(23)17(25-15-10-5-7-12-20-15)18(19(24)22(2)3)26-16-11-6-8-13-21-16/h5-8,10-13H,4,9H2,1-3H3/b18-17- |
| InChIKey | YLKLLZVISUGTDN-ZCXUNETKSA-N |
| XLogP | 4.03 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|