C10H13NO5S3 — CID 118532718
1-methoxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid (PubChem CID 118532718) has the molecular formula C10H13NO5S3 and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-methoxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid.
| Compound Name | 1-methoxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 118532718 |
| Molecular Formula | C10H13NO5S3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 1-methoxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
| SMILES | COC(=O)C(CCSSc1ccccn1)S(=O)(=O)O |
| InChI | InChI=1S/C10H13NO5S3/c1-16-10(12)8(19(13,14)15)5-7-17-18-9-4-2-3-6-11-9/h2-4,6,8H,5,7H2,1H3,(H,13,14,15) |
| InChIKey | VNUQTRAINCGMCX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|